C15H22FN4O3+ — CID 9223749
[2-(3-fluoroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]azanium (PubChem CID 9223749) has the molecular formula C15H22FN4O3+ and a molecular weight of 325.36 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]azanium.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 9223749 |
| Molecular Formula | C15H22FN4O3+ |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]azanium |
| SMILES | CC(C)NC(=O)NC(=O)C[NH+](C)CC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H21FN4O3/c1-10(2)17-15(23)19-14(22)9-20(3)8-13(21)18-12-6-4-5-11(16)7-12/h4-7,10H,8-9H2,1-3H3,(H,18,21)(H2,17,19,22,23)/p+1 |
| InChIKey | SKAFQRKCFQZZKV-UHFFFAOYSA-O |
| XLogP | -0.49 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |