C12H17FN3O2+ — CID 9223811
[(2S)-1-amino-1-oxopropan-2-yl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium (PubChem CID 9223811) has the molecular formula C12H17FN3O2+ and a molecular weight of 254.28 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9223811 |
| Molecular Formula | C12H17FN3O2+ |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[C@@H](C(N)=O)[NH+](C)CC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C12H16FN3O2/c1-8(12(14)18)16(2)7-11(17)15-10-5-3-4-9(13)6-10/h3-6,8H,7H2,1-2H3,(H2,14,18)(H,15,17)/p+1/t8-/m0/s1 |
| InChIKey | ORJJUFBENPIGSS-QMMMGPOBSA-O |
| XLogP | -0.85 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |