C12H15FN3O+ — CID 9223815
[(1S)-1-cyanoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium (PubChem CID 9223815) has the molecular formula C12H15FN3O+ and a molecular weight of 236.27 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [(1S)-1-cyanoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9223815 |
| Molecular Formula | C12H15FN3O+ |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | [(1S)-1-cyanoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[C@@H](C#N)[NH+](C)CC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C12H14FN3O/c1-9(7-14)16(2)8-12(17)15-11-5-3-4-10(13)6-11/h3-6,9H,8H2,1-2H3,(H,15,17)/p+1/t9-/m0/s1 |
| InChIKey | ALURLMRWIPXETG-VIFPVBQESA-O |
| XLogP | 0.19 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |