C17H22FN4O2+ — CID 9250377
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium (PubChem CID 9250377) has the molecular formula C17H22FN4O2+ and a molecular weight of 333.39 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9250377 |
| Molecular Formula | C17H22FN4O2+ |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1cccc(F)c1)CC(=O)NC1(C#N)CCCC1 |
| InChI | InChI=1S/C17H21FN4O2/c1-22(10-15(23)20-14-6-4-5-13(18)9-14)11-16(24)21-17(12-19)7-2-3-8-17/h4-6,9H,2-3,7-8,10-11H2,1H3,(H,20,23)(H,21,24)/p+1 |
| InChIKey | BUJIXNXUXLJPLF-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |