C22H31FN3O2+ — CID 9223781
[2-(1-adamantylmethylamino)-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium (PubChem CID 9223781) has the molecular formula C22H31FN3O2+ and a molecular weight of 388.51 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9223781 |
| Molecular Formula | C22H31FN3O2+ |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)NCC12CC3CC(CC(C3)C1)C2)CC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C22H30FN3O2/c1-26(13-21(28)25-19-4-2-3-18(23)8-19)12-20(27)24-14-22-9-15-5-16(10-22)7-17(6-15)11-22/h2-4,8,15-17H,5-7,9-14H2,1H3,(H,24,27)(H,25,28)/p+1 |
| InChIKey | BZYCSOUPXIIFSC-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |