C19H25FN5O4+ — CID 8538416
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium (PubChem CID 8538416) has the molecular formula C19H25FN5O4+ and a molecular weight of 406.44 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8538416 |
| Molecular Formula | C19H25FN5O4+ |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1cccc(F)c1)CC(=O)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C19H24FN5O4/c1-24(11-15(26)21-14-7-5-6-13(20)10-14)12-16(27)23-25-17(28)19(22-18(25)29)8-3-2-4-9-19/h5-7,10H,2-4,8-9,11-12H2,1H3,(H,21,26)(H,22,29)(H,23,27)/p+1 |
| InChIKey | XVNCCKAUSDVAFB-UHFFFAOYSA-O |
| XLogP | -0.44 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|