C18H23Cl2N4O3+ — CID 8538402
(2,4-dichlorophenyl)methyl-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-methylazanium (PubChem CID 8538402) has the molecular formula C18H23Cl2N4O3+ and a molecular weight of 414.31 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-methylazanium.
| Compound Name | (2,4-dichlorophenyl)methyl-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8538402 |
| Molecular Formula | C18H23Cl2N4O3+ |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | (2,4-dichlorophenyl)methyl-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)NN1C(=O)NC2(CCCCC2)C1=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H22Cl2N4O3/c1-23(10-12-5-6-13(19)9-14(12)20)11-15(25)22-24-16(26)18(21-17(24)27)7-3-2-4-8-18/h5-6,9H,2-4,7-8,10-11H2,1H3,(H,21,27)(H,22,25)/p+1 |
| InChIKey | NKPDZKBGXFORLI-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|