C18H24ClN4O3+ — CID 8598366
[(1S)-1-(2-chlorophenyl)ethyl]-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]azanium (PubChem CID 8598366) has the molecular formula C18H24ClN4O3+ and a molecular weight of 379.87 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl]-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl]-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8598366 |
| Molecular Formula | C18H24ClN4O3+ |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl]-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)NN1C(=O)NC2(CCCCC2)C1=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H23ClN4O3/c1-12(13-7-3-4-8-14(13)19)20-11-15(24)22-23-16(25)18(21-17(23)26)9-5-2-6-10-18/h3-4,7-8,12,20H,2,5-6,9-11H2,1H3,(H,21,26)(H,22,24)/p+1/t12-/m0/s1 |
| InChIKey | RFKFYNYJAJGTNA-LBPRGKRZSA-O |
| XLogP | 1.25 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|