C21H27ClN3O+ — CID 8593365
[(1S)-1-(2-chlorophenyl)ethyl]-[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]azanium (PubChem CID 8593365) has the molecular formula C21H27ClN3O+ and a molecular weight of 372.92 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl]-[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]azanium.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl]-[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8593365 |
| Molecular Formula | C21H27ClN3O+ |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl]-[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1ccc(N2CCCCC2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C21H26ClN3O/c1-16(19-7-3-4-8-20(19)22)23-15-21(26)24-17-9-11-18(12-10-17)25-13-5-2-6-14-25/h3-4,7-12,16,23H,2,5-6,13-15H2,1H3,(H,24,26)/p+1/t16-/m0/s1 |
| InChIKey | ACPQCCUMEPNJFS-INIZCTEOSA-O |
| XLogP | 3.59 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|