C23H26ClN3O4 — CID 55925646
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate (PubChem CID 55925646) has the molecular formula C23H26ClN3O4 and a molecular weight of 443.93 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55925646 |
| Molecular Formula | C23H26ClN3O4 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)c1ccccc1Cl)C(=O)OCC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H26ClN3O4/c1-16(25-22(29)19-7-3-4-8-20(19)24)23(30)31-15-21(28)26-17-9-11-18(12-10-17)27-13-5-2-6-14-27/h3-4,7-12,16H,2,5-6,13-15H2,1H3,(H,25,29)(H,26,28)/t16-/m0/s1 |
| InChIKey | YWSIIQQPXIWMJV-INIZCTEOSA-N |
| XLogP | 3.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|