C18H15ClF2N2O4 — CID 7570685
[2-(2,5-difluoroanilino)-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate (PubChem CID 7570685) has the molecular formula C18H15ClF2N2O4 and a molecular weight of 396.78 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7570685 |
| Molecular Formula | C18H15ClF2N2O4 |
| Molecular Weight | 396.78 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)c1ccccc1Cl)C(=O)OCC(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C18H15ClF2N2O4/c1-10(22-17(25)12-4-2-3-5-13(12)19)18(26)27-9-16(24)23-15-8-11(20)6-7-14(15)21/h2-8,10H,9H2,1H3,(H,22,25)(H,23,24)/t10-/m0/s1 |
| InChIKey | XBIKLWRENAIJPI-JTQLQIEISA-N |
| XLogP | 2.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.78 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |