C19H19ClN2O5 — CID 55925743
[2-(4-methoxyanilino)-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate (PubChem CID 55925743) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55925743 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate |
| SMILES | COc1ccc(NC(=O)COC(=O)[C@H](C)NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H19ClN2O5/c1-12(21-18(24)15-5-3-4-6-16(15)20)19(25)27-11-17(23)22-13-7-9-14(26-2)10-8-13/h3-10,12H,11H2,1-2H3,(H,21,24)(H,22,23)/t12-/m0/s1 |
| InChIKey | GJBUQGVYZFWLJW-LBPRGKRZSA-N |
| XLogP | 2.65 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |