C21H21ClF2N2O5 — CID 3449153
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]-3-methylbutanoate (PubChem CID 3449153) has the molecular formula C21H21ClF2N2O5 and a molecular weight of 454.86 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 3449153 |
| Molecular Formula | C21H21ClF2N2O5 |
| Molecular Weight | 454.86 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)C(NC(=O)c1ccccc1Cl)C(=O)OCC(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H21ClF2N2O5/c1-12(2)18(26-19(28)15-5-3-4-6-16(15)22)20(29)30-11-17(27)25-13-7-9-14(10-8-13)31-21(23)24/h3-10,12,18,21H,11H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | LRBCKPFDORYQPN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.86 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |