C18H22ClN3O5 — CID 7531932
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate (PubChem CID 7531932) has the molecular formula C18H22ClN3O5 and a molecular weight of 395.84 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7531932 |
| Molecular Formula | C18H22ClN3O5 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)[C@@H](NC(=O)c1ccccc1Cl)C(C)C |
| InChI | InChI=1S/C18H22ClN3O5/c1-4-9-20-18(26)21-14(23)10-27-17(25)15(11(2)3)22-16(24)12-7-5-6-8-13(12)19/h4-8,11,15H,1,9-10H2,2-3H3,(H,22,24)(H2,20,21,23,26)/t15-/m0/s1 |
| InChIKey | DXRIYIOZYOZYLN-HNNXBMFYSA-N |
| XLogP | 1.65 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|