C22H24F2N2O5 — CID 55324482
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 3-methyl-2-[(2-phenylacetyl)amino]butanoate (PubChem CID 55324482) has the molecular formula C22H24F2N2O5 and a molecular weight of 434.44 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 3-methyl-2-[(2-phenylacetyl)amino]butanoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 3-methyl-2-[(2-phenylacetyl)amino]butanoate |
|---|---|
| PubChem CID | 55324482 |
| Molecular Formula | C22H24F2N2O5 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 3-methyl-2-[(2-phenylacetyl)amino]butanoate |
| SMILES | CC(C)C(NC(=O)Cc1ccccc1)C(=O)OCC(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H24F2N2O5/c1-14(2)20(26-18(27)12-15-6-4-3-5-7-15)21(29)30-13-19(28)25-16-8-10-17(11-9-16)31-22(23)24/h3-11,14,20,22H,12-13H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | ZDNNYOXRCOJVPH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |