C16H21N3O5 — CID 7573092
[2-(carbamoylamino)-2-oxoethyl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate (PubChem CID 7573092) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate |
|---|---|
| PubChem CID | 7573092 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)OCC(=O)NC(N)=O |
| InChI | InChI=1S/C16H21N3O5/c1-10(2)14(15(22)24-9-13(21)19-16(17)23)18-12(20)8-11-6-4-3-5-7-11/h3-7,10,14H,8-9H2,1-2H3,(H,18,20)(H3,17,19,21,23)/t14-/m0/s1 |
| InChIKey | PCYRBNOCEPVLEH-AWEZNQCLSA-N |
| XLogP | 0.11 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |