C20H30N2O4 — CID 7573103
[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate (PubChem CID 7573103) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate.
| Compound Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate |
|---|---|
| PubChem CID | 7573103 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] (2S)-3-methyl-2-[(2-phenylacetyl)amino]butanoate |
| SMILES | CCC[C@@H](C)NC(=O)COC(=O)[C@@H](NC(=O)Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C20H30N2O4/c1-5-9-15(4)21-18(24)13-26-20(25)19(14(2)3)22-17(23)12-16-10-7-6-8-11-16/h6-8,10-11,14-15,19H,5,9,12-13H2,1-4H3,(H,21,24)(H,22,23)/t15-,19+/m1/s1 |
| InChIKey | NVZPITXBCFOTNK-BEFAXECRSA-N |
| XLogP | 2.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |