C25H30N3OS+ — CID 9298013
[2-[4-(azepan-1-yl)anilino]-2-oxoethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 9298013) has the molecular formula C25H30N3OS+ and a molecular weight of 420.60 g/mol. Its IUPAC name is [2-[4-(azepan-1-yl)anilino]-2-oxoethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9298013 |
| Molecular Formula | C25H30N3OS+ |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | O=C(C[NH2+][C@H](c1ccccc1)c1cccs1)Nc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C25H29N3OS/c29-24(19-26-25(23-11-8-18-30-23)20-9-4-3-5-10-20)27-21-12-14-22(15-13-21)28-16-6-1-2-7-17-28/h3-5,8-15,18,25-26H,1-2,6-7,16-17,19H2,(H,27,29)/p+1/t25-/m1/s1 |
| InChIKey | NNBODUYSYNVXCN-RUZDIDTESA-O |
| XLogP | 4.42 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|