C23H24FN3OS — CID 9297150
2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 9297150) has the molecular formula C23H24FN3OS and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 9297150 |
| Molecular Formula | C23H24FN3OS |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN[C@H](c1ccc(F)cc1)c1cccs1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C23H24FN3OS/c24-18-7-5-17(6-8-18)23(21-4-3-15-29-21)25-16-22(28)26-19-9-11-20(12-10-19)27-13-1-2-14-27/h3-12,15,23,25H,1-2,13-14,16H2,(H,26,28)/t23-/m1/s1 |
| InChIKey | LEOGSTGNLLVCQO-HSZRJFAPSA-N |
| XLogP | 4.81 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|