C14H14FNO2S — CID 94176340
methyl 2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]acetate (PubChem CID 94176340) has the molecular formula C14H14FNO2S and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl 2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]acetate.
| Compound Name | methyl 2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]acetate |
|---|---|
| PubChem CID | 94176340 |
| Molecular Formula | C14H14FNO2S |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | methyl 2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]acetate |
| SMILES | COC(=O)CN[C@H](c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C14H14FNO2S/c1-18-13(17)9-16-14(12-3-2-8-19-12)10-4-6-11(15)7-5-10/h2-8,14,16H,9H2,1H3/t14-/m1/s1 |
| InChIKey | HBBDDYGWHFBPDH-CQSZACIVSA-N |
| XLogP | 2.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |