C23H26N3OS+ — CID 9029961
[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 9029961) has the molecular formula C23H26N3OS+ and a molecular weight of 392.55 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9029961 |
| Molecular Formula | C23H26N3OS+ |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | O=C(C[NH2+][C@@H](c1ccccc1)c1cccs1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C23H25N3OS/c27-22(25-19-10-12-20(13-11-19)26-14-4-5-15-26)17-24-23(21-9-6-16-28-21)18-7-2-1-3-8-18/h1-3,6-13,16,23-24H,4-5,14-15,17H2,(H,25,27)/p+1/t23-/m0/s1 |
| InChIKey | PRCOHBLUSJIXSL-QHCPKHFHSA-O |
| XLogP | 3.64 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|