C21H23N2OS2+ — CID 8865511
[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 8865511) has the molecular formula C21H23N2OS2+ and a molecular weight of 383.56 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylethylamino)ethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 8865511 |
| Molecular Formula | C21H23N2OS2+ |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | O=C(C[NH2+][C@H](c1ccccc1)c1cccs1)NCCSc1ccccc1 |
| InChI | InChI=1S/C21H22N2OS2/c24-20(22-13-15-25-18-10-5-2-6-11-18)16-23-21(19-12-7-14-26-19)17-8-3-1-4-9-17/h1-12,14,21,23H,13,15-16H2,(H,22,24)/p+1/t21-/m1/s1 |
| InChIKey | PSQHHARLGYVOET-OAQYLSRUSA-O |
| XLogP | 3.31 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|