C23H27N2OS+ — CID 8862238
[2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 8862238) has the molecular formula C23H27N2OS+ and a molecular weight of 379.55 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 8862238 |
| Molecular Formula | C23H27N2OS+ |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)C[NH2+][C@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C23H26N2OS/c1-18(14-15-19-9-4-2-5-10-19)25-22(26)17-24-23(21-13-8-16-27-21)20-11-6-3-7-12-20/h2-13,16,18,23-24H,14-15,17H2,1H3,(H,25,26)/p+1/t18-,23-/m1/s1 |
| InChIKey | CWOIUGQASIAFDS-WZONZLPQSA-O |
| XLogP | 3.54 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |