C21H22FN2OS+ — CID 8862534
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 8862534) has the molecular formula C21H22FN2OS+ and a molecular weight of 369.49 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 8862534 |
| Molecular Formula | C21H22FN2OS+ |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | O=C(C[NH2+][C@H](c1ccccc1)c1cccs1)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN2OS/c22-18-10-8-16(9-11-18)12-13-23-20(25)15-24-21(19-7-4-14-26-19)17-5-2-1-3-6-17/h1-11,14,21,24H,12-13,15H2,(H,23,25)/p+1/t21-/m1/s1 |
| InChIKey | OMDWEGQNFSIICA-OAQYLSRUSA-O |
| XLogP | 2.90 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |