C20H31N3OS+2 — CID 8865704
tert-butyl-[3-[[2-[[(S)-phenyl(thiophen-2-yl)methyl]azaniumyl]acetyl]amino]propyl]azanium (PubChem CID 8865704) has the molecular formula C20H31N3OS+2 and a molecular weight of 361.56 g/mol. Its IUPAC name is tert-butyl-[3-[[2-[[(S)-phenyl(thiophen-2-yl)methyl]azaniumyl]acetyl]amino]propyl]azanium.
| Compound Name | tert-butyl-[3-[[2-[[(S)-phenyl(thiophen-2-yl)methyl]azaniumyl]acetyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 8865704 |
| Molecular Formula | C20H31N3OS+2 |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | tert-butyl-[3-[[2-[[(S)-phenyl(thiophen-2-yl)methyl]azaniumyl]acetyl]amino]propyl]azanium |
| SMILES | CC(C)(C)[NH2+]CCCNC(=O)C[NH2+][C@@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H29N3OS/c1-20(2,3)23-13-8-12-21-18(24)15-22-19(17-11-7-14-25-17)16-9-5-4-6-10-16/h4-7,9-11,14,19,22-23H,8,12-13,15H2,1-3H3,(H,21,24)/p+2/t19-/m0/s1 |
| InChIKey | QCYHIESJHYJLLP-IBGZPJMESA-P |
| XLogP | 1.27 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|