C21H23N2OS+ — CID 8862498
[2-(3-ethylanilino)-2-oxoethyl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 8862498) has the molecular formula C21H23N2OS+ and a molecular weight of 351.50 g/mol. Its IUPAC name is [2-(3-ethylanilino)-2-oxoethyl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | [2-(3-ethylanilino)-2-oxoethyl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 8862498 |
| Molecular Formula | C21H23N2OS+ |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [2-(3-ethylanilino)-2-oxoethyl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | CCc1cccc(NC(=O)C[NH2+][C@@H](c2ccccc2)c2cccs2)c1 |
| InChI | InChI=1S/C21H22N2OS/c1-2-16-8-6-11-18(14-16)23-20(24)15-22-21(19-12-7-13-25-19)17-9-4-3-5-10-17/h3-14,21-22H,2,15H2,1H3,(H,23,24)/p+1/t21-/m0/s1 |
| InChIKey | KRVAPXFCKCSEFE-NRFANRHFSA-O |
| XLogP | 3.60 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |