C20H20ClN2OS+ — CID 9051679
[2-(3-chloroanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium (PubChem CID 9051679) has the molecular formula C20H20ClN2OS+ and a molecular weight of 371.91 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium |
|---|---|
| PubChem CID | 9051679 |
| Molecular Formula | C20H20ClN2OS+ |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl]-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium |
| SMILES | Cc1ccc([C@H]([NH2+]CC(=O)Nc2cccc(Cl)c2)c2cccs2)cc1 |
| InChI | InChI=1S/C20H19ClN2OS/c1-14-7-9-15(10-8-14)20(18-6-3-11-25-18)22-13-19(24)23-17-5-2-4-16(21)12-17/h2-12,20,22H,13H2,1H3,(H,23,24)/p+1/t20-/m0/s1 |
| InChIKey | QPVPLNJQYIPALN-FQEVSTJZSA-O |
| XLogP | 4.00 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |