C20H20N3O3S+ — CID 9051888
[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]-[2-(3-nitroanilino)-2-oxoethyl]azanium (PubChem CID 9051888) has the molecular formula C20H20N3O3S+ and a molecular weight of 382.47 g/mol. Its IUPAC name is [(S)-(4-methylphenyl)-thiophen-2-ylmethyl]-[2-(3-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | [(S)-(4-methylphenyl)-thiophen-2-ylmethyl]-[2-(3-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9051888 |
| Molecular Formula | C20H20N3O3S+ |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [(S)-(4-methylphenyl)-thiophen-2-ylmethyl]-[2-(3-nitroanilino)-2-oxoethyl]azanium |
| SMILES | Cc1ccc([C@H]([NH2+]CC(=O)Nc2cccc([N+](=O)[O-])c2)c2cccs2)cc1 |
| InChI | InChI=1S/C20H19N3O3S/c1-14-7-9-15(10-8-14)20(18-6-3-11-27-18)21-13-19(24)22-16-4-2-5-17(12-16)23(25)26/h2-12,20-21H,13H2,1H3,(H,22,24)/p+1/t20-/m0/s1 |
| InChIKey | VZXXFYYWVAXEDR-FQEVSTJZSA-O |
| XLogP | 3.26 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|