C23H26N3O3S+ — CID 8998040
[2-(2-methyl-6-nitroanilino)-2-oxoethyl]-[(R)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]azanium (PubChem CID 8998040) has the molecular formula C23H26N3O3S+ and a molecular weight of 424.55 g/mol. Its IUPAC name is [2-(2-methyl-6-nitroanilino)-2-oxoethyl]-[(R)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]azanium.
| Compound Name | [2-(2-methyl-6-nitroanilino)-2-oxoethyl]-[(R)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]azanium |
|---|---|
| PubChem CID | 8998040 |
| Molecular Formula | C23H26N3O3S+ |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [2-(2-methyl-6-nitroanilino)-2-oxoethyl]-[(R)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]azanium |
| SMILES | Cc1cccc([N+](=O)[O-])c1NC(=O)C[NH2+][C@H](c1ccc(C(C)C)cc1)c1cccs1 |
| InChI | InChI=1S/C23H25N3O3S/c1-15(2)17-9-11-18(12-10-17)23(20-8-5-13-30-20)24-14-21(27)25-22-16(3)6-4-7-19(22)26(28)29/h4-13,15,23-24H,14H2,1-3H3,(H,25,27)/p+1/t23-/m1/s1 |
| InChIKey | ZMELUTXNNXPAED-HSZRJFAPSA-O |
| XLogP | 4.38 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|