C23H24N3O3+ — CID 8548634
benzhydryl-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]azanium (PubChem CID 8548634) has the molecular formula C23H24N3O3+ and a molecular weight of 390.46 g/mol. Its IUPAC name is benzhydryl-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | benzhydryl-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8548634 |
| Molecular Formula | C23H24N3O3+ |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | benzhydryl-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]azanium |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)C[NH2+]C(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C23H23N3O3/c1-16-13-14-20(26(28)29)22(17(16)2)25-21(27)15-24-23(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-14,23-24H,15H2,1-2H3,(H,25,27)/p+1 |
| InChIKey | OKUKGWQXWKYNOU-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|