C24H25N3O3 — CID 8710728
N-(2,3-dimethyl-6-nitrophenyl)-2-[[(R)-(4-methylphenyl)-phenylmethyl]amino]acetamide (PubChem CID 8710728) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is N-(2,3-dimethyl-6-nitrophenyl)-2-[[(R)-(4-methylphenyl)-phenylmethyl]amino]acetamide.
| Compound Name | N-(2,3-dimethyl-6-nitrophenyl)-2-[[(R)-(4-methylphenyl)-phenylmethyl]amino]acetamide |
|---|---|
| PubChem CID | 8710728 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-(2,3-dimethyl-6-nitrophenyl)-2-[[(R)-(4-methylphenyl)-phenylmethyl]amino]acetamide |
| SMILES | Cc1ccc([C@H](NCC(=O)Nc2c([N+](=O)[O-])ccc(C)c2C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-16-9-12-20(13-10-16)24(19-7-5-4-6-8-19)25-15-22(28)26-23-18(3)17(2)11-14-21(23)27(29)30/h4-14,24-25H,15H2,1-3H3,(H,26,28)/t24-/m1/s1 |
| InChIKey | YOVPASHLPMUTSQ-XMMPIXPASA-N |
| XLogP | 4.84 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|