C20H25N4O4S+ — CID 8558894
[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium (PubChem CID 8558894) has the molecular formula C20H25N4O4S+ and a molecular weight of 417.51 g/mol. Its IUPAC name is [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8558894 |
| Molecular Formula | C20H25N4O4S+ |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium |
| SMILES | CSc1ccccc1NC(=O)C[NH+](C)CC(=O)Nc1c([N+](=O)[O-])ccc(C)c1C |
| InChI | InChI=1S/C20H24N4O4S/c1-13-9-10-16(24(27)28)20(14(13)2)22-19(26)12-23(3)11-18(25)21-15-7-5-6-8-17(15)29-4/h5-10H,11-12H2,1-4H3,(H,21,25)(H,22,26)/p+1 |
| InChIKey | HRCSMNTYGRLPDG-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|