C20H23FN3O3+ — CID 8978323
cyclopropyl-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-[(2-fluorophenyl)methyl]azanium (PubChem CID 8978323) has the molecular formula C20H23FN3O3+ and a molecular weight of 372.42 g/mol. Its IUPAC name is cyclopropyl-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-[(2-fluorophenyl)methyl]azanium.
| Compound Name | cyclopropyl-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-[(2-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 8978323 |
| Molecular Formula | C20H23FN3O3+ |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | cyclopropyl-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-[(2-fluorophenyl)methyl]azanium |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)C[NH+](Cc2ccccc2F)C2CC2)c1C |
| InChI | InChI=1S/C20H22FN3O3/c1-13-7-10-18(24(26)27)20(14(13)2)22-19(25)12-23(16-8-9-16)11-15-5-3-4-6-17(15)21/h3-7,10,16H,8-9,11-12H2,1-2H3,(H,22,25)/p+1 |
| InChIKey | WMPJTNSEQABXKA-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|