C18H18BrF2N2O+ — CID 8977699
[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]-cyclopropyl-[(2-fluorophenyl)methyl]azanium (PubChem CID 8977699) has the molecular formula C18H18BrF2N2O+ and a molecular weight of 396.26 g/mol. Its IUPAC name is [2-(4-bromo-2-fluoroanilino)-2-oxoethyl]-cyclopropyl-[(2-fluorophenyl)methyl]azanium.
| Compound Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl]-cyclopropyl-[(2-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 8977699 |
| Molecular Formula | C18H18BrF2N2O+ |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl]-cyclopropyl-[(2-fluorophenyl)methyl]azanium |
| SMILES | O=C(C[NH+](Cc1ccccc1F)C1CC1)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C18H17BrF2N2O/c19-13-5-8-17(16(21)9-13)22-18(24)11-23(14-6-7-14)10-12-3-1-2-4-15(12)20/h1-5,8-9,14H,6-7,10-11H2,(H,22,24)/p+1 |
| InChIKey | ZKXCWIXKCHLGSI-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |