C17H25FN3O2+ — CID 8978143
cyclopropyl-[(2-fluorophenyl)methyl]-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]azanium (PubChem CID 8978143) has the molecular formula C17H25FN3O2+ and a molecular weight of 322.40 g/mol. Its IUPAC name is cyclopropyl-[(2-fluorophenyl)methyl]-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]azanium.
| Compound Name | cyclopropyl-[(2-fluorophenyl)methyl]-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8978143 |
| Molecular Formula | C17H25FN3O2+ |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | cyclopropyl-[(2-fluorophenyl)methyl]-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]azanium |
| SMILES | CC(C)CNC(=O)NC(=O)C[NH+](Cc1ccccc1F)C1CC1 |
| InChI | InChI=1S/C17H24FN3O2/c1-12(2)9-19-17(23)20-16(22)11-21(14-7-8-14)10-13-5-3-4-6-15(13)18/h3-6,12,14H,7-11H2,1-2H3,(H2,19,20,22,23)/p+1 |
| InChIKey | UDKHFBBYMGTNMV-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |