C19H21F2N2O+ — CID 8906982
cyclopropyl-[(4-fluorophenyl)methyl]-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]azanium (PubChem CID 8906982) has the molecular formula C19H21F2N2O+ and a molecular weight of 331.39 g/mol. Its IUPAC name is cyclopropyl-[(4-fluorophenyl)methyl]-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]azanium.
| Compound Name | cyclopropyl-[(4-fluorophenyl)methyl]-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8906982 |
| Molecular Formula | C19H21F2N2O+ |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | cyclopropyl-[(4-fluorophenyl)methyl]-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]azanium |
| SMILES | O=C(C[NH+](Cc1ccc(F)cc1)C1CC1)NCc1ccccc1F |
| InChI | InChI=1S/C19H20F2N2O/c20-16-7-5-14(6-8-16)12-23(17-9-10-17)13-19(24)22-11-15-3-1-2-4-18(15)21/h1-8,17H,9-13H2,(H,22,24)/p+1 |
| InChIKey | YYRBRUKCWWKAQB-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |