C20H20F4N3O2+ — CID 8905793
cyclopropyl-[(4-fluorophenyl)methyl]-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium (PubChem CID 8905793) has the molecular formula C20H20F4N3O2+ and a molecular weight of 410.39 g/mol. Its IUPAC name is cyclopropyl-[(4-fluorophenyl)methyl]-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium.
| Compound Name | cyclopropyl-[(4-fluorophenyl)methyl]-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 8905793 |
| Molecular Formula | C20H20F4N3O2+ |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | cyclopropyl-[(4-fluorophenyl)methyl]-[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl]azanium |
| SMILES | O=C(C[NH+](Cc1ccc(F)cc1)C1CC1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H19F4N3O2/c21-13-3-1-12(2-4-13)10-27(14-5-6-14)11-18(29)25-9-17(28)26-16-8-7-15(22)19(23)20(16)24/h1-4,7-8,14H,5-6,9-11H2,(H,25,29)(H,26,28)/p+1 |
| InChIKey | PWIGOSXIGGKMHR-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|