C20H22FN2O3+ — CID 8904985
cyclopropyl-[(4-fluorophenyl)methyl]-[2-(2-methoxycarbonylanilino)-2-oxoethyl]azanium (PubChem CID 8904985) has the molecular formula C20H22FN2O3+ and a molecular weight of 357.41 g/mol. Its IUPAC name is cyclopropyl-[(4-fluorophenyl)methyl]-[2-(2-methoxycarbonylanilino)-2-oxoethyl]azanium.
| Compound Name | cyclopropyl-[(4-fluorophenyl)methyl]-[2-(2-methoxycarbonylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8904985 |
| Molecular Formula | C20H22FN2O3+ |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | cyclopropyl-[(4-fluorophenyl)methyl]-[2-(2-methoxycarbonylanilino)-2-oxoethyl]azanium |
| SMILES | COC(=O)c1ccccc1NC(=O)C[NH+](Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C20H21FN2O3/c1-26-20(25)17-4-2-3-5-18(17)22-19(24)13-23(16-10-11-16)12-14-6-8-15(21)9-7-14/h2-9,16H,10-13H2,1H3,(H,22,24)/p+1 |
| InChIKey | UTFBEVXFDAYSPQ-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |