C20H24FN2O+ — CID 8872573
cyclopropyl-[2-(4-ethylanilino)-2-oxoethyl]-[(4-fluorophenyl)methyl]azanium (PubChem CID 8872573) has the molecular formula C20H24FN2O+ and a molecular weight of 327.42 g/mol. Its IUPAC name is cyclopropyl-[2-(4-ethylanilino)-2-oxoethyl]-[(4-fluorophenyl)methyl]azanium.
| Compound Name | cyclopropyl-[2-(4-ethylanilino)-2-oxoethyl]-[(4-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 8872573 |
| Molecular Formula | C20H24FN2O+ |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | cyclopropyl-[2-(4-ethylanilino)-2-oxoethyl]-[(4-fluorophenyl)methyl]azanium |
| SMILES | CCc1ccc(NC(=O)C[NH+](Cc2ccc(F)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C20H23FN2O/c1-2-15-5-9-18(10-6-15)22-20(24)14-23(19-11-12-19)13-16-3-7-17(21)8-4-16/h3-10,19H,2,11-14H2,1H3,(H,22,24)/p+1 |
| InChIKey | UMWPOHKDJUXRPE-UHFFFAOYSA-O |
| XLogP | 2.57 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |