C25H26FN2O+ — CID 8905358
[2-(2-benzylanilino)-2-oxoethyl]-cyclopropyl-[(4-fluorophenyl)methyl]azanium (PubChem CID 8905358) has the molecular formula C25H26FN2O+ and a molecular weight of 389.49 g/mol. Its IUPAC name is [2-(2-benzylanilino)-2-oxoethyl]-cyclopropyl-[(4-fluorophenyl)methyl]azanium.
| Compound Name | [2-(2-benzylanilino)-2-oxoethyl]-cyclopropyl-[(4-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 8905358 |
| Molecular Formula | C25H26FN2O+ |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [2-(2-benzylanilino)-2-oxoethyl]-cyclopropyl-[(4-fluorophenyl)methyl]azanium |
| SMILES | O=C(C[NH+](Cc1ccc(F)cc1)C1CC1)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C25H25FN2O/c26-22-12-10-20(11-13-22)17-28(23-14-15-23)18-25(29)27-24-9-5-4-8-21(24)16-19-6-2-1-3-7-19/h1-13,23H,14-18H2,(H,27,29)/p+1 |
| InChIKey | TVCUKTHBQXVUHF-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |