C19H22FN2O3S+ — CID 8906848
cyclopropyl-[(4-fluorophenyl)methyl]-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium (PubChem CID 8906848) has the molecular formula C19H22FN2O3S+ and a molecular weight of 377.46 g/mol. Its IUPAC name is cyclopropyl-[(4-fluorophenyl)methyl]-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium.
| Compound Name | cyclopropyl-[(4-fluorophenyl)methyl]-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8906848 |
| Molecular Formula | C19H22FN2O3S+ |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | cyclopropyl-[(4-fluorophenyl)methyl]-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)C[NH+](Cc2ccc(F)cc2)C2CC2)c1 |
| InChI | InChI=1S/C19H21FN2O3S/c1-26(24,25)18-4-2-3-16(11-18)21-19(23)13-22(17-9-10-17)12-14-5-7-15(20)8-6-14/h2-8,11,17H,9-10,12-13H2,1H3,(H,21,23)/p+1 |
| InChIKey | HRFFRKMXIVQWTH-UHFFFAOYSA-O |
| XLogP | 1.42 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |