C19H24N3O4S+ — CID 8770207
cyclopropyl-[(4-methoxyphenyl)methyl]-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium (PubChem CID 8770207) has the molecular formula C19H24N3O4S+ and a molecular weight of 390.49 g/mol. Its IUPAC name is cyclopropyl-[(4-methoxyphenyl)methyl]-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium.
| Compound Name | cyclopropyl-[(4-methoxyphenyl)methyl]-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8770207 |
| Molecular Formula | C19H24N3O4S+ |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | cyclopropyl-[(4-methoxyphenyl)methyl]-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium |
| SMILES | COc1ccc(C[NH+](CC(=O)Nc2cccc(S(N)(=O)=O)c2)C2CC2)cc1 |
| InChI | InChI=1S/C19H23N3O4S/c1-26-17-9-5-14(6-10-17)12-22(16-7-8-16)13-19(23)21-15-3-2-4-18(11-15)27(20,24)25/h2-6,9-11,16H,7-8,12-13H2,1H3,(H,21,23)(H2,20,24,25)/p+1 |
| InChIKey | UMZXCGICBUXDFJ-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |