C20H18N2O4S — CID 34752671
(E)-3-(6-methoxynaphthalen-2-yl)-N-(3-sulfamoylphenyl)prop-2-enamide (PubChem CID 34752671) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is (E)-3-(6-methoxynaphthalen-2-yl)-N-(3-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(6-methoxynaphthalen-2-yl)-N-(3-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 34752671 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (E)-3-(6-methoxynaphthalen-2-yl)-N-(3-sulfamoylphenyl)prop-2-enamide |
| SMILES | COc1ccc2cc(/C=C/C(=O)Nc3cccc(S(N)(=O)=O)c3)ccc2c1 |
| InChI | InChI=1S/C20H18N2O4S/c1-26-18-9-8-15-11-14(5-7-16(15)12-18)6-10-20(23)22-17-3-2-4-19(13-17)27(21,24)25/h2-13H,1H3,(H,22,23)(H2,21,24,25)/b10-6+ |
| InChIKey | XPYFAKURTNWSCM-UXBLZVDNSA-N |
| XLogP | 3.15 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|