C15H14N2O3S — CID 5348189
(E)-3-phenyl-N-(3-sulfamoylphenyl)prop-2-enamide (PubChem CID 5348189) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is (E)-3-phenyl-N-(3-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-(3-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5348189 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (E)-3-phenyl-N-(3-sulfamoylphenyl)prop-2-enamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C15H14N2O3S/c16-21(19,20)14-8-4-7-13(11-14)17-15(18)10-9-12-5-2-1-3-6-12/h1-11H,(H,17,18)(H2,16,19,20)/b10-9+ |
| InChIKey | TUSZAVRAFVPUIC-MDZDMXLPSA-N |
| XLogP | 1.99 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|