C15H14N2O4S — CID 72945216
(E)-3-(3-hydroxyphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 72945216) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is (E)-3-(3-hydroxyphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-hydroxyphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 72945216 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (E)-3-(3-hydroxyphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)/C=C/c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C15H14N2O4S/c16-22(20,21)14-7-5-12(6-8-14)17-15(19)9-4-11-2-1-3-13(18)10-11/h1-10,18H,(H,17,19)(H2,16,20,21)/b9-4+ |
| InChIKey | HYUVSLSFTYZHBG-RUDMXATFSA-N |
| XLogP | 1.69 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|