C22H20N2O4S — CID 35053594
(E)-3-(3-phenylmethoxyphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 35053594) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is (E)-3-(3-phenylmethoxyphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-phenylmethoxyphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 35053594 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | (E)-3-(3-phenylmethoxyphenyl)-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)/C=C/c2cccc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C22H20N2O4S/c23-29(26,27)21-12-10-19(11-13-21)24-22(25)14-9-17-7-4-8-20(15-17)28-16-18-5-2-1-3-6-18/h1-15H,16H2,(H,24,25)(H2,23,26,27)/b14-9+ |
| InChIKey | NDDDRVZCPRNTMC-NTEUORMPSA-N |
| XLogP | 3.56 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|