C26H23N3O5S3 — CID 16631674
2-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide (PubChem CID 16631674) has the molecular formula C26H23N3O5S3 and a molecular weight of 553.69 g/mol. Its IUPAC name is 2-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 2-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 16631674 |
| Molecular Formula | C26H23N3O5S3 |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.08 |
| IUPAC Name | 2-[(5Z)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(S(N)(=O)=O)cc1)N1C(=O)/C(=C/c2cccc(OCc3ccccc3)c2)SC1=S |
| InChI | InChI=1S/C26H23N3O5S3/c1-17(24(30)28-20-10-12-22(13-11-20)37(27,32)33)29-25(31)23(36-26(29)35)15-19-8-5-9-21(14-19)34-16-18-6-3-2-4-7-18/h2-15,17H,16H2,1H3,(H,28,30)(H2,27,32,33)/b23-15- |
| InChIKey | HRQRXXXNPNPRMJ-HAHDFKILSA-N |
| XLogP | 4.14 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|