C22H19ClN2O2 — CID 28867666
(E)-N-(3-amino-4-chlorophenyl)-3-(4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 28867666) has the molecular formula C22H19ClN2O2 and a molecular weight of 378.86 g/mol. Its IUPAC name is (E)-N-(3-amino-4-chlorophenyl)-3-(4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(3-amino-4-chlorophenyl)-3-(4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 28867666 |
| Molecular Formula | C22H19ClN2O2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | (E)-N-(3-amino-4-chlorophenyl)-3-(4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | Nc1cc(NC(=O)/C=C/c2ccc(OCc3ccccc3)cc2)ccc1Cl |
| InChI | InChI=1S/C22H19ClN2O2/c23-20-12-9-18(14-21(20)24)25-22(26)13-8-16-6-10-19(11-7-16)27-15-17-4-2-1-3-5-17/h1-14H,15,24H2,(H,25,26)/b13-8+ |
| InChIKey | MGOSSQGRCFDTIQ-MDWZMJQESA-N |
| XLogP | 5.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|