C27H26ClNO4 — CID 10298471
2-chloro-5-[[(E)-3-[4-(5-phenylpentoxy)phenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 10298471) has the molecular formula C27H26ClNO4 and a molecular weight of 463.96 g/mol. Its IUPAC name is 2-chloro-5-[[(E)-3-[4-(5-phenylpentoxy)phenyl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-chloro-5-[[(E)-3-[4-(5-phenylpentoxy)phenyl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 10298471 |
| Molecular Formula | C27H26ClNO4 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-chloro-5-[[(E)-3-[4-(5-phenylpentoxy)phenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(OCCCCCc2ccccc2)cc1)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C27H26ClNO4/c28-25-16-13-22(19-24(25)27(31)32)29-26(30)17-12-21-10-14-23(15-11-21)33-18-6-2-5-9-20-7-3-1-4-8-20/h1,3-4,7-8,10-17,19H,2,5-6,9,18H2,(H,29,30)(H,31,32)/b17-12+ |
| InChIKey | GPHYFIFMKGQLKR-SFQUDFHCSA-N |
| XLogP | 6.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|