C24H23NO2 — CID 3591323
N-(4-ethylphenyl)-3-(4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 3591323) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3-(4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | N-(4-ethylphenyl)-3-(4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3591323 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-(4-ethylphenyl)-3-(4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | CCc1ccc(NC(=O)C=Cc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H23NO2/c1-2-19-8-13-22(14-9-19)25-24(26)17-12-20-10-15-23(16-11-20)27-18-21-6-4-3-5-7-21/h3-17H,2,18H2,1H3,(H,25,26) |
| InChIKey | ISKXYBCWCDKWQD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|